C17H32O3Si — CID 134887719
(E)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethylnon-3-en-5-yne-2,7-diol (PubChem CID 134887719) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (E)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethylnon-3-en-5-yne-2,7-diol.
| Compound Name | (E)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethylnon-3-en-5-yne-2,7-diol |
|---|---|
| PubChem CID | 134887719 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (E)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethylnon-3-en-5-yne-2,7-diol |
| SMILES | CCC(O)C#C/C=C(\C)C(C)(O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-9-15(18)12-10-11-14(2)17(6,19)13-20-21(7,8)16(3,4)5/h11,15,18-19H,9,13H2,1-8H3/b14-11+ |
| InChIKey | PQPRCAIFLFCPMD-SDNWHVSQSA-N |
| XLogP | 3.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|