C21H30O5SSi — CID 134887766
ethyl 4,5-dimethoxy-3-phenylsulfanyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate (PubChem CID 134887766) has the molecular formula C21H30O5SSi and a molecular weight of 422.62 g/mol. Its IUPAC name is ethyl 4,5-dimethoxy-3-phenylsulfanyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate.
| Compound Name | ethyl 4,5-dimethoxy-3-phenylsulfanyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 134887766 |
| Molecular Formula | C21H30O5SSi |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | ethyl 4,5-dimethoxy-3-phenylsulfanyl-4-trimethylsilyloxycyclohepta-1,5-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(Sc2ccccc2)C(OC)(O[Si](C)(C)C)C(OC)=CC1 |
| InChI | InChI=1S/C21H30O5SSi/c1-7-25-20(22)16-13-14-18(23-2)21(24-3,26-28(4,5)6)19(15-16)27-17-11-9-8-10-12-17/h8-12,14-15,19H,7,13H2,1-6H3 |
| InChIKey | CQBQPYILKHVWEF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|