C30H33Br3O9 — CID 134887788
7,15,23-tribromo-25,26,27-tris(methoxymethoxy)-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene (PubChem CID 134887788) has the molecular formula C30H33Br3O9 and a molecular weight of 777.30 g/mol. Its IUPAC name is 7,15,23-tribromo-25,26,27-tris(methoxymethoxy)-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene.
| Compound Name | 7,15,23-tribromo-25,26,27-tris(methoxymethoxy)-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene |
|---|---|
| PubChem CID | 134887788 |
| Molecular Formula | C30H33Br3O9 |
| Molecular Weight | 777.30 g/mol |
| Exact Mass | 773.97 |
| IUPAC Name | 7,15,23-tribromo-25,26,27-tris(methoxymethoxy)-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene |
| SMILES | COCOc1c2cc(Br)cc1COCc1cc(Br)cc(c1OCOC)COCc1cc(Br)cc(c1OCOC)COC2 |
| InChI | InChI=1S/C30H33Br3O9/c1-34-16-40-28-19-4-25(31)5-20(28)11-38-13-22-7-27(33)9-24(30(22)42-18-36-3)15-39-14-23-8-26(32)6-21(12-37-10-19)29(23)41-17-35-2/h4-9H,10-18H2,1-3H3 |
| InChIKey | IVYHGQMYDZHCNH-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.30 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|