C18H26O4 — CID 134887792
4-O-tert-butyl 1-O-ethyl 1,1a,2,3,4,5,6,6a-octahydrocyclopropa[f]indene-1,4-dicarboxylate (PubChem CID 134887792) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-ethyl 1,1a,2,3,4,5,6,6a-octahydrocyclopropa[f]indene-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-ethyl 1,1a,2,3,4,5,6,6a-octahydrocyclopropa[f]indene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134887792 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 4-O-tert-butyl 1-O-ethyl 1,1a,2,3,4,5,6,6a-octahydrocyclopropa[f]indene-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1C2CC3=C(CC(C(=O)OC(C)(C)C)C3)CC21 |
| InChI | InChI=1S/C18H26O4/c1-5-21-17(20)15-13-8-10-6-12(7-11(10)9-14(13)15)16(19)22-18(2,3)4/h12-15H,5-9H2,1-4H3 |
| InChIKey | OIXHIPGGDJRGAA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|