About 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium
2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium (PubChem CID 134888102) has the molecular formula C9H9S2+
and a molecular weight of 181.31 g/mol. Its IUPAC name is 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium.
Molecular Properties
| Compound Name | 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium |
| PubChem CID | 134888102 |
| Molecular Formula | C9H9S2+ |
| Molecular Weight | 181.31 g/mol |
| Exact Mass | 181.01 |
| IUPAC Name | 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium |
| SMILES | C1=CC=C2SCC[S+]=C2C=C1 |
| InChI | InChI=1S/C9H9S2/c1-2-4-8-9(5-3-1)11-7-6-10-8/h1-5H,6-7H2/q+1 |
| InChIKey | BGUHCBRUOMUOGZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium?
The IUPAC name of 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium (CID 134888102) is 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium.
What is the SMILES notation for 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium?
The canonical SMILES for 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium is C1=CC=C2SCC[S+]=C2C=C1.
What is the InChIKey of 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium?
The InChIKey is BGUHCBRUOMUOGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9S2/c1-2-4-8-9(5-3-1)11-7-6-10-8/h1-5H,6-7H2/q+1.
What are the key properties of 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium?
2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium has a molecular weight of 181.31 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrocyclohepta[b][1,4]dithiin-4-ium is sourced from PubChem (CID 134888102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).