About zinc;dichlorocopper(1-);methyl benzoate
zinc;dichlorocopper(1-);methyl benzoate (PubChem CID 134888438) has the molecular formula C8H7Cl2CuO2Zn
and a molecular weight of 334.98 g/mol. Its IUPAC name is zinc;dichlorocopper(1-);methyl benzoate.
Molecular Properties
| Compound Name | zinc;dichlorocopper(1-);methyl benzoate |
| PubChem CID | 134888438 |
| Molecular Formula | C8H7Cl2CuO2Zn |
| Molecular Weight | 334.98 g/mol |
| Exact Mass | 331.84 |
| IUPAC Name | zinc;dichlorocopper(1-);methyl benzoate |
| SMILES | COC(=O)c1c[c-]ccc1.Cl[Cu-]Cl.[Zn+2] |
| InChI | InChI=1S/C8H7O2.2ClH.Cu.Zn/c1-10-8(9)7-5-3-2-4-6-7;;;;/h2-3,5-6H,1H3;2*1H;;/q-1;;;+1;+2/p-2 |
| InChIKey | YGTGZGQUELDFLC-UHFFFAOYSA-L |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.98 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;dichlorocopper(1-);methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;dichlorocopper(1-);methyl benzoate?
The IUPAC name of zinc;dichlorocopper(1-);methyl benzoate (CID 134888438) is zinc;dichlorocopper(1-);methyl benzoate.
What is the SMILES notation for zinc;dichlorocopper(1-);methyl benzoate?
The canonical SMILES for zinc;dichlorocopper(1-);methyl benzoate is COC(=O)c1c[c-]ccc1.Cl[Cu-]Cl.[Zn+2].
What is the InChIKey of zinc;dichlorocopper(1-);methyl benzoate?
The InChIKey is YGTGZGQUELDFLC-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H7O2.2ClH.Cu.Zn/c1-10-8(9)7-5-3-2-4-6-7;;;;/h2-3,5-6H,1H3;2*1H;;/q-1;;;+1;+2/p-2.
What are the key properties of zinc;dichlorocopper(1-);methyl benzoate?
zinc;dichlorocopper(1-);methyl benzoate has a molecular weight of 334.98 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;dichlorocopper(1-);methyl benzoate is sourced from PubChem (CID 134888438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).