C11H15F3O2 — CID 134888606
(5R,6S)-5,6-diethoxy-1-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 134888606) has the molecular formula C11H15F3O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is (5R,6S)-5,6-diethoxy-1-(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | (5R,6S)-5,6-diethoxy-1-(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 134888606 |
| Molecular Formula | C11H15F3O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (5R,6S)-5,6-diethoxy-1-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | CCO[C@@H]1C=CC=C(C(F)(F)F)[C@@H]1OCC |
| InChI | InChI=1S/C11H15F3O2/c1-3-15-9-7-5-6-8(11(12,13)14)10(9)16-4-2/h5-7,9-10H,3-4H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | RGYMAPWWNLJHMS-ZJUUUORDSA-N |
| XLogP | 2.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |