C11H18O2 — CID 134888756
(5R,6S)-5,6-diethoxy-1-methylcyclohexa-1,3-diene (PubChem CID 134888756) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (5R,6S)-5,6-diethoxy-1-methylcyclohexa-1,3-diene.
| Compound Name | (5R,6S)-5,6-diethoxy-1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 134888756 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (5R,6S)-5,6-diethoxy-1-methylcyclohexa-1,3-diene |
| SMILES | CCO[C@@H]1C=CC=C(C)[C@@H]1OCC |
| InChI | InChI=1S/C11H18O2/c1-4-12-10-8-6-7-9(3)11(10)13-5-2/h6-8,10-11H,4-5H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | JPNOPELIAXKAQX-MNOVXSKESA-N |
| XLogP | 2.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |