C10H18O3 — CID 134888858
(E)-3-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-en-1-ol (PubChem CID 134888858) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (E)-3-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 134888858 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (E)-3-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-en-1-ol |
| SMILES | C[C@@H]1COC(C)(C)O[C@H]1/C=C/CO |
| InChI | InChI=1S/C10H18O3/c1-8-7-12-10(2,3)13-9(8)5-4-6-11/h4-5,8-9,11H,6-7H2,1-3H3/b5-4+/t8-,9+/m1/s1 |
| InChIKey | HNRRUFFPXDLILV-VJIGKBMESA-N |
| XLogP | 1.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|