About 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol
2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol (PubChem CID 134888883) has the molecular formula C19H20N2O
and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol.
Molecular Properties
| Compound Name | 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol |
| PubChem CID | 134888883 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol |
| SMILES | CC1(C)C=C(C(CO)(c2ccccc2)c2ccccc2)N=N1 |
| InChI | InChI=1S/C19H20N2O/c1-18(2)13-17(20-21-18)19(14-22,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-13,22H,14H2,1-2H3 |
| InChIKey | NJSZPSQVQXNNAK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol?
The IUPAC name of 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol (CID 134888883) is 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol.
What is the SMILES notation for 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol?
The canonical SMILES for 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol is CC1(C)C=C(C(CO)(c2ccccc2)c2ccccc2)N=N1.
What is the InChIKey of 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol?
The InChIKey is NJSZPSQVQXNNAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O/c1-18(2)13-17(20-21-18)19(14-22,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-13,22H,14H2,1-2H3.
What are the key properties of 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol?
2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol has a molecular weight of 292.38 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethylpyrazol-3-yl)-2,2-diphenylethanol is sourced from PubChem (CID 134888883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).