About tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane
tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane (PubChem CID 134889012) has the molecular formula C30H51B
and a molecular weight of 422.55 g/mol. Its IUPAC name is tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane.
Molecular Properties
| Compound Name | tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane |
| PubChem CID | 134889012 |
| Molecular Formula | C30H51B |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.41 |
| IUPAC Name | tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane |
| SMILES | CC1(C)C2CC[C@H](CB(C[C@H]3CCC4CC3C4(C)C)C[C@H]3CCC4CC3C4(C)C)C1C2 |
| InChI | InChI=1S/C30H51B/c1-28(2)22-10-7-19(25(28)13-22)16-31(17-20-8-11-23-14-26(20)29(23,3)4)18-21-9-12-24-15-27(21)30(24,5)6/h19-27H,7-18H2,1-6H3/t19-,20-,21-,22?,23?,24?,25?,26?,27?/m1/s1 |
| InChIKey | DSJLJZCYWBDQAF-XOSNHBCNSA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane?
The IUPAC name of tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane (CID 134889012) is tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane.
What is the SMILES notation for tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane?
The canonical SMILES for tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane is CC1(C)C2CC[C@H](CB(C[C@H]3CCC4CC3C4(C)C)C[C@H]3CCC4CC3C4(C)C)C1C2.
What is the InChIKey of tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane?
The InChIKey is DSJLJZCYWBDQAF-XOSNHBCNSA-N. The full InChI is InChI=1S/C30H51B/c1-28(2)22-10-7-19(25(28)13-22)16-31(17-20-8-11-23-14-26(20)29(23,3)4)18-21-9-12-24-15-27(21)30(24,5)6/h19-27H,7-18H2,1-6H3/t19-,20-,21-,22?,23?,24?,25?,26?,27?/m1/s1.
What are the key properties of tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane?
tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane has a molecular weight of 422.55 g/mol, XLogP of 8.70, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]borane is sourced from PubChem (CID 134889012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).