C19H30O2 — CID 134889058
(4S)-4-[2-[(1S,2S,4S,5S)-4-hydroxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-4-methylcyclohex-2-en-1-one (PubChem CID 134889058) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (4S)-4-[2-[(1S,2S,4S,5S)-4-hydroxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-4-methylcyclohex-2-en-1-one.
| Compound Name | (4S)-4-[2-[(1S,2S,4S,5S)-4-hydroxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-4-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 134889058 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (4S)-4-[2-[(1S,2S,4S,5S)-4-hydroxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-4-methylcyclohex-2-en-1-one |
| SMILES | CC1(C)[C@@H]2C[C@H]1[C@@](C)(CC[C@]1(C)C=CC(=O)CC1)C[C@@H]2O |
| InChI | InChI=1S/C19H30O2/c1-17(2)14-11-16(17)19(4,12-15(14)21)10-9-18(3)7-5-13(20)6-8-18/h5,7,14-16,21H,6,8-12H2,1-4H3/t14-,15+,16-,18-,19+/m1/s1 |
| InChIKey | CIPBXWWCVWJUGE-DARIXABFSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |