About (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene
(4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene (PubChem CID 134889080) has the molecular formula C18H30N2O2Si
and a molecular weight of 334.54 g/mol. Its IUPAC name is (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene |
| PubChem CID | 134889080 |
| Molecular Formula | C18H30N2O2Si |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene |
| SMILES | COc1cc2c(cc1OC)/C(=N/N[Si](C)(C)C(C)(C)C)CCC2 |
| InChI | InChI=1S/C18H30N2O2Si/c1-18(2,3)23(6,7)20-19-15-10-8-9-13-11-16(21-4)17(22-5)12-14(13)15/h11-12,20H,8-10H2,1-7H3/b19-15+ |
| InChIKey | TVTHRBHCWNQTKH-XDJHFCHBSA-N |
| XLogP | 4.34 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene?
The IUPAC name of (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene (CID 134889080) is (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene?
The canonical SMILES for (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene is COc1cc2c(cc1OC)/C(=N/N[Si](C)(C)C(C)(C)C)CCC2.
What is the InChIKey of (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene?
The InChIKey is TVTHRBHCWNQTKH-XDJHFCHBSA-N. The full InChI is InChI=1S/C18H30N2O2Si/c1-18(2,3)23(6,7)20-19-15-10-8-9-13-11-16(21-4)17(22-5)12-14(13)15/h11-12,20H,8-10H2,1-7H3/b19-15+.
What are the key properties of (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene?
(4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene has a molecular weight of 334.54 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-[[tert-butyl(dimethyl)silyl]hydrazinylidene]-6,7-dimethoxy-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 134889080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).