C15H14F6O3 — CID 134889184
1,1,1,3,3,3-hexafluoropropan-2-yl [(3S)-5-phenylpent-1-en-3-yl] carbonate (PubChem CID 134889184) has the molecular formula C15H14F6O3 and a molecular weight of 356.26 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl [(3S)-5-phenylpent-1-en-3-yl] carbonate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl [(3S)-5-phenylpent-1-en-3-yl] carbonate |
|---|---|
| PubChem CID | 134889184 |
| Molecular Formula | C15H14F6O3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl [(3S)-5-phenylpent-1-en-3-yl] carbonate |
| SMILES | C=C[C@H](CCc1ccccc1)OC(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H14F6O3/c1-2-11(9-8-10-6-4-3-5-7-10)23-13(22)24-12(14(16,17)18)15(19,20)21/h2-7,11-12H,1,8-9H2/t11-/m1/s1 |
| InChIKey | CMHSBGCBLFWROB-LLVKDONJSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|