C18H24O10 — CID 134889338
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(1E)-buta-1,3-dienoxy]oxan-2-yl]methyl acetate (PubChem CID 134889338) has the molecular formula C18H24O10 and a molecular weight of 400.38 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(1E)-buta-1,3-dienoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(1E)-buta-1,3-dienoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134889338 |
| Molecular Formula | C18H24O10 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(1E)-buta-1,3-dienoxy]oxan-2-yl]methyl acetate |
| SMILES | C=C/C=C/O[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H24O10/c1-6-7-8-23-18-17(27-13(5)22)16(26-12(4)21)15(25-11(3)20)14(28-18)9-24-10(2)19/h6-8,14-18H,1,9H2,2-5H3/b8-7+/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | QJYZZUXNUBNGGV-XGBPFYHNSA-N |
| XLogP | 0.79 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|