C18H28O2Si — CID 134889384
(E)-1-[2-[(1E,3E)-penta-1,3-dienyl]-4-trimethylsilyloxycyclohex-3-en-1-yl]but-2-en-1-one (PubChem CID 134889384) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is (E)-1-[2-[(1E,3E)-penta-1,3-dienyl]-4-trimethylsilyloxycyclohex-3-en-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-[2-[(1E,3E)-penta-1,3-dienyl]-4-trimethylsilyloxycyclohex-3-en-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 134889384 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (E)-1-[2-[(1E,3E)-penta-1,3-dienyl]-4-trimethylsilyloxycyclohex-3-en-1-yl]but-2-en-1-one |
| SMILES | C/C=C/C=C/C1C=C(O[Si](C)(C)C)CCC1C(=O)/C=C/C |
| InChI | InChI=1S/C18H28O2Si/c1-6-8-9-11-15-14-16(20-21(3,4)5)12-13-17(15)18(19)10-7-2/h6-11,14-15,17H,12-13H2,1-5H3/b8-6+,10-7+,11-9+ |
| InChIKey | ZHKBDHSLGZWDBW-HWTJUQGWSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|