About carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium
carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium (PubChem CID 134889398) has the molecular formula C15H16CrO6
and a molecular weight of 344.28 g/mol. Its IUPAC name is carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium.
Molecular Properties
| Compound Name | carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium |
| PubChem CID | 134889398 |
| Molecular Formula | C15H16CrO6 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium |
| SMILES | COC(=[Cr])C1CCC(C)=C(C)C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C10H16O.5CO.Cr/c1-8-4-5-10(7-11-3)6-9(8)2;5*1-2;/h10H,4-6H2,1-3H3;;;;;; |
| InChIKey | AMPKROYCVFFKRH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium?
The IUPAC name of carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium (CID 134889398) is carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium.
What is the SMILES notation for carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium?
The canonical SMILES for carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium is COC(=[Cr])C1CCC(C)=C(C)C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].
What is the InChIKey of carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium?
The InChIKey is AMPKROYCVFFKRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.5CO.Cr/c1-8-4-5-10(7-11-3)6-9(8)2;5*1-2;/h10H,4-6H2,1-3H3;;;;;;.
What are the key properties of carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium?
carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium has a molecular weight of 344.28 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;[(3,4-dimethylcyclohex-3-en-1-yl)-methoxymethylidene]chromium is sourced from PubChem (CID 134889398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).