C13H17IO6 — CID 134889469
methyl (3aR,4S,7aS)-5-[(1S,2R)-1,2-dihydroxy-3-iodopropyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate (PubChem CID 134889469) has the molecular formula C13H17IO6 and a molecular weight of 396.18 g/mol. Its IUPAC name is methyl (3aR,4S,7aS)-5-[(1S,2R)-1,2-dihydroxy-3-iodopropyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate.
| Compound Name | methyl (3aR,4S,7aS)-5-[(1S,2R)-1,2-dihydroxy-3-iodopropyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 134889469 |
| Molecular Formula | C13H17IO6 |
| Molecular Weight | 396.18 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | methyl (3aR,4S,7aS)-5-[(1S,2R)-1,2-dihydroxy-3-iodopropyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@H]1C([C@H](O)[C@@H](O)CI)C=C[C@@H]2COC(=O)[C@H]21 |
| InChI | InChI=1S/C13H17IO6/c1-19-12(17)10-7(11(16)8(15)4-14)3-2-6-5-20-13(18)9(6)10/h2-3,6-11,15-16H,4-5H2,1H3/t6-,7?,8+,9-,10+,11+/m1/s1 |
| InChIKey | UDFHWILSYHKZRU-YQXGXZSCSA-N |
| XLogP | -0.09 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|