About lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate
lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate (PubChem CID 134889537) has the molecular formula C14H23LiO
and a molecular weight of 214.28 g/mol. Its IUPAC name is lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate.
Molecular Properties
| Compound Name | lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate |
| PubChem CID | 134889537 |
| Molecular Formula | C14H23LiO |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate |
| SMILES | CCCC/C([O-])=C1\C(C)=CCCC1(C)C.[Li+] |
| InChI | InChI=1S/C14H24O.Li/c1-5-6-9-12(15)13-11(2)8-7-10-14(13,3)4;/h8,15H,5-7,9-10H2,1-4H3;/q;+1/p-1/b13-12-; |
| InChIKey | HMPJJFOQVWBZEF-USGGBSEESA-M |
| XLogP | 0.56 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate?
The IUPAC name of lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate (CID 134889537) is lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate.
What is the SMILES notation for lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate?
The canonical SMILES for lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate is CCCC/C([O-])=C1\C(C)=CCCC1(C)C.[Li+].
What is the InChIKey of lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate?
The InChIKey is HMPJJFOQVWBZEF-USGGBSEESA-M. The full InChI is InChI=1S/C14H24O.Li/c1-5-6-9-12(15)13-11(2)8-7-10-14(13,3)4;/h8,15H,5-7,9-10H2,1-4H3;/q;+1/p-1/b13-12-;.
What are the key properties of lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate?
lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate has a molecular weight of 214.28 g/mol, XLogP of 0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-olate is sourced from PubChem (CID 134889537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).