C14H24O — CID 134889538
(1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol (PubChem CID 134889538) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol.
| Compound Name | (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol |
|---|---|
| PubChem CID | 134889538 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol |
| SMILES | CCCC/C(O)=C1\C(C)=CCCC1(C)C |
| InChI | InChI=1S/C14H24O/c1-5-6-9-12(15)13-11(2)8-7-10-14(13,3)4/h8,15H,5-7,9-10H2,1-4H3/b13-12- |
| InChIKey | AAKHXLGACBUPMG-SEYXRHQNSA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|