About (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol
(1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol (PubChem CID 134889538) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol.
Molecular Properties
| Compound Name | (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol |
| PubChem CID | 134889538 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol |
| SMILES | CCCC/C(O)=C1\C(C)=CCCC1(C)C |
| InChI | InChI=1S/C14H24O/c1-5-6-9-12(15)13-11(2)8-7-10-14(13,3)4/h8,15H,5-7,9-10H2,1-4H3/b13-12- |
| InChIKey | AAKHXLGACBUPMG-SEYXRHQNSA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol?
The IUPAC name of (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol (CID 134889538) is (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol.
What is the SMILES notation for (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol?
The canonical SMILES for (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol is CCCC/C(O)=C1\C(C)=CCCC1(C)C.
What is the InChIKey of (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol?
The InChIKey is AAKHXLGACBUPMG-SEYXRHQNSA-N. The full InChI is InChI=1S/C14H24O/c1-5-6-9-12(15)13-11(2)8-7-10-14(13,3)4/h8,15H,5-7,9-10H2,1-4H3/b13-12-.
What are the key properties of (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol?
(1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol has a molecular weight of 208.34 g/mol, XLogP of 4.76, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pentan-1-ol is sourced from PubChem (CID 134889538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).