About (2Z)-1-chloro-3,8-dimethylnona-2,7-diene
(2Z)-1-chloro-3,8-dimethylnona-2,7-diene (PubChem CID 134889632) has the molecular formula C11H19Cl
and a molecular weight of 186.73 g/mol. Its IUPAC name is (2Z)-1-chloro-3,8-dimethylnona-2,7-diene.
Molecular Properties
| Compound Name | (2Z)-1-chloro-3,8-dimethylnona-2,7-diene |
| PubChem CID | 134889632 |
| Molecular Formula | C11H19Cl |
| Molecular Weight | 186.73 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (2Z)-1-chloro-3,8-dimethylnona-2,7-diene |
| SMILES | CC(C)=CCCC/C(C)=C\CCl |
| InChI | InChI=1S/C11H19Cl/c1-10(2)6-4-5-7-11(3)8-9-12/h6,8H,4-5,7,9H2,1-3H3/b11-8- |
| InChIKey | JIMNSIBHSAASRD-FLIBITNWSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-1-chloro-3,8-dimethylnona-2,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1-chloro-3,8-dimethylnona-2,7-diene?
The IUPAC name of (2Z)-1-chloro-3,8-dimethylnona-2,7-diene (CID 134889632) is (2Z)-1-chloro-3,8-dimethylnona-2,7-diene.
What is the SMILES notation for (2Z)-1-chloro-3,8-dimethylnona-2,7-diene?
The canonical SMILES for (2Z)-1-chloro-3,8-dimethylnona-2,7-diene is CC(C)=CCCC/C(C)=C\CCl.
What is the InChIKey of (2Z)-1-chloro-3,8-dimethylnona-2,7-diene?
The InChIKey is JIMNSIBHSAASRD-FLIBITNWSA-N. The full InChI is InChI=1S/C11H19Cl/c1-10(2)6-4-5-7-11(3)8-9-12/h6,8H,4-5,7,9H2,1-3H3/b11-8-.
What are the key properties of (2Z)-1-chloro-3,8-dimethylnona-2,7-diene?
(2Z)-1-chloro-3,8-dimethylnona-2,7-diene has a molecular weight of 186.73 g/mol, XLogP of 4.31, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1-chloro-3,8-dimethylnona-2,7-diene is sourced from PubChem (CID 134889632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).