C11H17KO — CID 134889666
potassium (4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-2-olate (PubChem CID 134889666) has the molecular formula C11H17KO and a molecular weight of 204.35 g/mol. Its IUPAC name is potassium (4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-2-olate.
| Compound Name | potassium (4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-2-olate |
|---|---|
| PubChem CID | 134889666 |
| Molecular Formula | C11H17KO |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | potassium (4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-3H-naphthalen-2-olate |
| SMILES | C[C@@]12CCCC[C@H]1C=C([O-])CC2.[K+] |
| InChI | InChI=1S/C11H18O.K/c1-11-6-3-2-4-9(11)8-10(12)5-7-11;/h8-9,12H,2-7H2,1H3;/q;+1/p-1/t9-,11-;/m0./s1 |
| InChIKey | CYEBTFBLIWJLBI-ROLPUNSJSA-M |
| XLogP | -0.78 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |