C12H21BO2 — CID 134889699
(1S,2S,6R,8S)-4-ethyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 134889699) has the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. Its IUPAC name is (1S,2S,6R,8S)-4-ethyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6R,8S)-4-ethyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 134889699 |
| Molecular Formula | C12H21BO2 |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (1S,2S,6R,8S)-4-ethyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CCB1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C12H21BO2/c1-5-13-14-10-7-8-6-9(11(8,2)3)12(10,4)15-13/h8-10H,5-7H2,1-4H3/t8-,9-,10+,12-/m0/s1 |
| InChIKey | RJNDETPCVOUWAT-GUDRVLHUSA-N |
| XLogP | 2.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|