C14H26O3Si — CID 134889714
methyl (Z)-5-(3,3-dimethyloxiran-2-yl)-3-(trimethylsilylmethyl)pent-2-enoate (PubChem CID 134889714) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is methyl (Z)-5-(3,3-dimethyloxiran-2-yl)-3-(trimethylsilylmethyl)pent-2-enoate.
| Compound Name | methyl (Z)-5-(3,3-dimethyloxiran-2-yl)-3-(trimethylsilylmethyl)pent-2-enoate |
|---|---|
| PubChem CID | 134889714 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | methyl (Z)-5-(3,3-dimethyloxiran-2-yl)-3-(trimethylsilylmethyl)pent-2-enoate |
| SMILES | COC(=O)/C=C(/CCC1OC1(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C14H26O3Si/c1-14(2)12(17-14)8-7-11(9-13(15)16-3)10-18(4,5)6/h9,12H,7-8,10H2,1-6H3/b11-9- |
| InChIKey | WBVWGRBMZTUSKM-LUAWRHEFSA-N |
| XLogP | 3.38 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|