C15H28O2Si — CID 134889730
trans-(2S,3R)-2,3-dimethyl-2-(3-oxo-2-trimethylsilylbutyl)cyclohexan-1-one (PubChem CID 134889730) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is trans-(2S,3R)-2,3-dimethyl-2-(3-oxo-2-trimethylsilylbutyl)cyclohexan-1-one.
| Compound Name | trans-(2S,3R)-2,3-dimethyl-2-(3-oxo-2-trimethylsilylbutyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 134889730 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | trans-(2S,3R)-2,3-dimethyl-2-(3-oxo-2-trimethylsilylbutyl)cyclohexan-1-one |
| SMILES | CC(=O)C(C[C@]1(C)C(=O)CCC[C@H]1C)[Si](C)(C)C |
| InChI | InChI=1S/C15H28O2Si/c1-11-8-7-9-14(17)15(11,3)10-13(12(2)16)18(4,5)6/h11,13H,7-10H2,1-6H3/t11-,13?,15+/m1/s1 |
| InChIKey | IKODTOUNVINQRE-ZHOBSPGKSA-N |
| XLogP | 4.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|