C14H20O4 — CID 134889830
[(1S,7aS)-1-acetyloxy-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-yl] acetate (PubChem CID 134889830) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is [(1S,7aS)-1-acetyloxy-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-yl] acetate.
| Compound Name | [(1S,7aS)-1-acetyloxy-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-yl] acetate |
|---|---|
| PubChem CID | 134889830 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [(1S,7aS)-1-acetyloxy-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-yl] acetate |
| SMILES | CC(=O)OC1C=C2CC[C@H](OC(C)=O)[C@@]2(C)CC1 |
| InChI | InChI=1S/C14H20O4/c1-9(15)17-12-6-7-14(3)11(8-12)4-5-13(14)18-10(2)16/h8,12-13H,4-7H2,1-3H3/t12?,13-,14-/m0/s1 |
| InChIKey | HGMNELILOJXCEK-TTZKSVMKSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|