C21H22O2 — CID 134889866
(4R,5R)-2-[(1E,3E)-hexa-1,3-dienyl]-4,5-diphenyl-1,3-dioxolane (PubChem CID 134889866) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (4R,5R)-2-[(1E,3E)-hexa-1,3-dienyl]-4,5-diphenyl-1,3-dioxolane.
| Compound Name | (4R,5R)-2-[(1E,3E)-hexa-1,3-dienyl]-4,5-diphenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134889866 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (4R,5R)-2-[(1E,3E)-hexa-1,3-dienyl]-4,5-diphenyl-1,3-dioxolane |
| SMILES | CC/C=C/C=C/C1O[C@H](c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C21H22O2/c1-2-3-4-11-16-19-22-20(17-12-7-5-8-13-17)21(23-19)18-14-9-6-10-15-18/h3-16,19-21H,2H2,1H3/b4-3+,16-11+/t20-,21-/m1/s1 |
| InChIKey | GCMIKFQGOWSHAP-DZWHEKINSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|