About O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate
O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate (PubChem CID 134889917) has the molecular formula C14H18N2OS
and a molecular weight of 262.38 g/mol. Its IUPAC name is O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate.
Molecular Properties
| Compound Name | O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate |
| PubChem CID | 134889917 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate |
| SMILES | C=CCC/C(=N/N(C)C(=S)OC)c1ccccc1 |
| InChI | InChI=1S/C14H18N2OS/c1-4-5-11-13(12-9-7-6-8-10-12)15-16(2)14(18)17-3/h4,6-10H,1,5,11H2,2-3H3/b15-13- |
| InChIKey | RHYZQMSZNSLPGM-SQFISAMPSA-N |
| XLogP | 3.22 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate?
The IUPAC name of O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate (CID 134889917) is O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate.
What is the SMILES notation for O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate?
The canonical SMILES for O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate is C=CCC/C(=N/N(C)C(=S)OC)c1ccccc1.
What is the InChIKey of O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate?
The InChIKey is RHYZQMSZNSLPGM-SQFISAMPSA-N. The full InChI is InChI=1S/C14H18N2OS/c1-4-5-11-13(12-9-7-6-8-10-12)15-16(2)14(18)17-3/h4,6-10H,1,5,11H2,2-3H3/b15-13-.
What are the key properties of O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate?
O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate has a molecular weight of 262.38 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl N-methyl-N-[(Z)-1-phenylpent-4-enylideneamino]carbamothioate is sourced from PubChem (CID 134889917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).