About 6-methyl-N-propylocta-4,5-dien-1-amine
6-methyl-N-propylocta-4,5-dien-1-amine (PubChem CID 134889931) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 6-methyl-N-propylocta-4,5-dien-1-amine.
Molecular Properties
| Compound Name | 6-methyl-N-propylocta-4,5-dien-1-amine |
| PubChem CID | 134889931 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 6-methyl-N-propylocta-4,5-dien-1-amine |
| SMILES | CCCNCCCC=C=C(C)CC |
| InChI | InChI=1S/C12H23N/c1-4-10-13-11-8-6-7-9-12(3)5-2/h7,13H,4-6,8,10-11H2,1-3H3 |
| InChIKey | PIDNXFCAICZQET-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-N-propylocta-4,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-N-propylocta-4,5-dien-1-amine?
The IUPAC name of 6-methyl-N-propylocta-4,5-dien-1-amine (CID 134889931) is 6-methyl-N-propylocta-4,5-dien-1-amine.
What is the SMILES notation for 6-methyl-N-propylocta-4,5-dien-1-amine?
The canonical SMILES for 6-methyl-N-propylocta-4,5-dien-1-amine is CCCNCCCC=C=C(C)CC.
What is the InChIKey of 6-methyl-N-propylocta-4,5-dien-1-amine?
The InChIKey is PIDNXFCAICZQET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-4-10-13-11-8-6-7-9-12(3)5-2/h7,13H,4-6,8,10-11H2,1-3H3.
What are the key properties of 6-methyl-N-propylocta-4,5-dien-1-amine?
6-methyl-N-propylocta-4,5-dien-1-amine has a molecular weight of 181.32 g/mol, XLogP of 3.28, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-N-propylocta-4,5-dien-1-amine is sourced from PubChem (CID 134889931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).