C12H18O5 — CID 134889935
diethyl 2-[(E)-2-[(2S,3S)-3-methyloxiran-2-yl]ethenyl]propanedioate (PubChem CID 134889935) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is diethyl 2-[(E)-2-[(2S,3S)-3-methyloxiran-2-yl]ethenyl]propanedioate.
| Compound Name | diethyl 2-[(E)-2-[(2S,3S)-3-methyloxiran-2-yl]ethenyl]propanedioate |
|---|---|
| PubChem CID | 134889935 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | diethyl 2-[(E)-2-[(2S,3S)-3-methyloxiran-2-yl]ethenyl]propanedioate |
| SMILES | CCOC(=O)C(/C=C/[C@@H]1O[C@H]1C)C(=O)OCC |
| InChI | InChI=1S/C12H18O5/c1-4-15-11(13)9(12(14)16-5-2)6-7-10-8(3)17-10/h6-10H,4-5H2,1-3H3/b7-6+/t8-,10-/m0/s1 |
| InChIKey | ILUVIWVNRLNZMU-ANAVPXRGSA-N |
| XLogP | 1.07 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|