About chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury
chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury (PubChem CID 134889965) has the molecular formula C8H12ClHgNO
and a molecular weight of 374.23 g/mol. Its IUPAC name is chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury.
Molecular Properties
| Compound Name | chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury |
| PubChem CID | 134889965 |
| Molecular Formula | C8H12ClHgNO |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury |
| SMILES | CO[C@H]1CC[C@H](C#N)C[C@@H]1[Hg]Cl |
| InChI | InChI=1S/C8H12NO.ClH.Hg/c1-10-8-4-2-7(6-9)3-5-8;;/h4,7-8H,2-3,5H2,1H3;1H;/q;;+1/p-1/t7-,8-;;/m1../s1 |
| InChIKey | DEBIMKFDCBCFOW-RHJRFJOKSA-M |
| XLogP | 2.35 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury?
The IUPAC name of chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury (CID 134889965) is chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury.
What is the SMILES notation for chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury?
The canonical SMILES for chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury is CO[C@H]1CC[C@H](C#N)C[C@@H]1[Hg]Cl.
What is the InChIKey of chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury?
The InChIKey is DEBIMKFDCBCFOW-RHJRFJOKSA-M. The full InChI is InChI=1S/C8H12NO.ClH.Hg/c1-10-8-4-2-7(6-9)3-5-8;;/h4,7-8H,2-3,5H2,1H3;1H;/q;;+1/p-1/t7-,8-;;/m1../s1.
What are the key properties of chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury?
chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury has a molecular weight of 374.23 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[(1S,2S,5S)-5-cyano-2-methoxycyclohexyl]mercury is sourced from PubChem (CID 134889965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).