About bis[(1S,2R)-2-methoxycyclohexyl]mercury
bis[(1S,2R)-2-methoxycyclohexyl]mercury (PubChem CID 134889988) has the molecular formula C14H26HgO2
and a molecular weight of 426.95 g/mol. Its IUPAC name is bis[(1S,2R)-2-methoxycyclohexyl]mercury.
Molecular Properties
| Compound Name | bis[(1S,2R)-2-methoxycyclohexyl]mercury |
| PubChem CID | 134889988 |
| Molecular Formula | C14H26HgO2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | bis[(1S,2R)-2-methoxycyclohexyl]mercury |
| SMILES | CO[C@@H]1CCCC[C@@H]1[Hg][C@H]1CCCC[C@H]1OC |
| InChI | InChI=1S/2C7H13O.Hg/c2*1-8-7-5-3-2-4-6-7;/h2*5,7H,2-4,6H2,1H3;/t2*7-;/m00./s1 |
| InChIKey | AQOUNLLTOJGONT-UBKPKTQASA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis[(1S,2R)-2-methoxycyclohexyl]mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(1S,2R)-2-methoxycyclohexyl]mercury?
The IUPAC name of bis[(1S,2R)-2-methoxycyclohexyl]mercury (CID 134889988) is bis[(1S,2R)-2-methoxycyclohexyl]mercury.
What is the SMILES notation for bis[(1S,2R)-2-methoxycyclohexyl]mercury?
The canonical SMILES for bis[(1S,2R)-2-methoxycyclohexyl]mercury is CO[C@@H]1CCCC[C@@H]1[Hg][C@H]1CCCC[C@H]1OC.
What is the InChIKey of bis[(1S,2R)-2-methoxycyclohexyl]mercury?
The InChIKey is AQOUNLLTOJGONT-UBKPKTQASA-N. The full InChI is InChI=1S/2C7H13O.Hg/c2*1-8-7-5-3-2-4-6-7;/h2*5,7H,2-4,6H2,1H3;/t2*7-;/m00./s1.
What are the key properties of bis[(1S,2R)-2-methoxycyclohexyl]mercury?
bis[(1S,2R)-2-methoxycyclohexyl]mercury has a molecular weight of 426.95 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(1S,2R)-2-methoxycyclohexyl]mercury is sourced from PubChem (CID 134889988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).