About [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate
[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate (PubChem CID 134890104) has the molecular formula C9H16O2Si
and a molecular weight of 184.31 g/mol. Its IUPAC name is [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate.
Molecular Properties
| Compound Name | [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate |
| PubChem CID | 134890104 |
| Molecular Formula | C9H16O2Si |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate |
| SMILES | CC(=O)O/C=C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C9H16O2Si/c1-9(10)11-7-5-6-8-12(2,3)4/h5-8H,1-4H3/b7-5+,8-6+ |
| InChIKey | XBNICDVYGHMISB-KQQUZDAGSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate?
The IUPAC name of [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate (CID 134890104) is [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate.
What is the SMILES notation for [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate?
The canonical SMILES for [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate is CC(=O)O/C=C/C=C/[Si](C)(C)C.
What is the InChIKey of [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate?
The InChIKey is XBNICDVYGHMISB-KQQUZDAGSA-N. The full InChI is InChI=1S/C9H16O2Si/c1-9(10)11-7-5-6-8-12(2,3)4/h5-8H,1-4H3/b7-5+,8-6+.
What are the key properties of [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate?
[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate has a molecular weight of 184.31 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E,3E)-4-trimethylsilylbuta-1,3-dienyl] acetate is sourced from PubChem (CID 134890104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).