About CID 134890124
CID 134890124 (PubChem CID 134890124) has the molecular formula C6H6
and a molecular weight of 78.11 g/mol.
Molecular Properties
| Compound Name | CID 134890124 |
| PubChem CID | 134890124 |
| Molecular Formula | C6H6 |
| Molecular Weight | 78.11 g/mol |
| Exact Mass | 78.05 |
| IUPAC Name | — |
| SMILES | [C]=C=C=C(C)C |
| InChI | InChI=1S/C6H6/c1-4-5-6(2)3/h2-3H3 |
| InChIKey | PSRQDBMVLJWFFA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.11 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 134890124 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134890124?
The IUPAC name of CID 134890124 (CID 134890124) is not available.
What is the SMILES notation for CID 134890124?
The canonical SMILES for CID 134890124 is [C]=C=C=C(C)C.
What is the InChIKey of CID 134890124?
The InChIKey is PSRQDBMVLJWFFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6/c1-4-5-6(2)3/h2-3H3.
What are the key properties of CID 134890124?
CID 134890124 has a molecular weight of 78.11 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134890124 is sourced from PubChem (CID 134890124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).