C14H24O2 — CID 134890243
4-butyl-5-cyclohexyl-2,5-dihydrofuran-2-ol (PubChem CID 134890243) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 4-butyl-5-cyclohexyl-2,5-dihydrofuran-2-ol.
| Compound Name | 4-butyl-5-cyclohexyl-2,5-dihydrofuran-2-ol |
|---|---|
| PubChem CID | 134890243 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 4-butyl-5-cyclohexyl-2,5-dihydrofuran-2-ol |
| SMILES | CCCCC1=CC(O)OC1C1CCCCC1 |
| InChI | InChI=1S/C14H24O2/c1-2-3-7-12-10-13(15)16-14(12)11-8-5-4-6-9-11/h10-11,13-15H,2-9H2,1H3 |
| InChIKey | POGVBRXCVJPYAT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|