About 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene
3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene (PubChem CID 134890345) has the molecular formula C11H10FIS3
and a molecular weight of 384.30 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene |
| PubChem CID | 134890345 |
| Molecular Formula | C11H10FIS3 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.90 |
| IUPAC Name | 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene |
| SMILES | CSC1=S(I)SC(c2ccc(F)cc2)=C1C |
| InChI | InChI=1S/C11H10FIS3/c1-7-10(15-16(13)11(7)14-2)8-3-5-9(12)6-4-8/h3-6H,1-2H3 |
| InChIKey | FJJTXHFKQLELTI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene?
The IUPAC name of 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene (CID 134890345) is 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene.
What is the SMILES notation for 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene?
The canonical SMILES for 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene is CSC1=S(I)SC(c2ccc(F)cc2)=C1C.
What is the InChIKey of 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene?
The InChIKey is FJJTXHFKQLELTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FIS3/c1-7-10(15-16(13)11(7)14-2)8-3-5-9(12)6-4-8/h3-6H,1-2H3.
What are the key properties of 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene?
3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene has a molecular weight of 384.30 g/mol, XLogP of 5.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-1-iodo-4-methyl-5-methylsulfanyl-1λ4,2-dithiacyclopenta-3,5-diene is sourced from PubChem (CID 134890345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).