C15H27NO2 — CID 134890490
(4S,6R)-2,2-dimethyl-4-pentyl-6-propan-2-yl-1,3-dioxane-4-carbonitrile (PubChem CID 134890490) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (4S,6R)-2,2-dimethyl-4-pentyl-6-propan-2-yl-1,3-dioxane-4-carbonitrile.
| Compound Name | (4S,6R)-2,2-dimethyl-4-pentyl-6-propan-2-yl-1,3-dioxane-4-carbonitrile |
|---|---|
| PubChem CID | 134890490 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (4S,6R)-2,2-dimethyl-4-pentyl-6-propan-2-yl-1,3-dioxane-4-carbonitrile |
| SMILES | CCCCC[C@@]1(C#N)C[C@H](C(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C15H27NO2/c1-6-7-8-9-15(11-16)10-13(12(2)3)17-14(4,5)18-15/h12-13H,6-10H2,1-5H3/t13-,15+/m1/s1 |
| InChIKey | IJKZLQQONJFRNT-HIFRSBDPSA-N |
| XLogP | 4.03 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|