About 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine
5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine (PubChem CID 134890575) has the molecular formula C12H18BCl
and a molecular weight of 208.54 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine.
Molecular Properties
| Compound Name | 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine |
| PubChem CID | 134890575 |
| Molecular Formula | C12H18BCl |
| Molecular Weight | 208.54 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine |
| SMILES | C=CCB1C=C(CCl)CC(CC=C)C1 |
| InChI | InChI=1S/C12H18BCl/c1-3-5-11-7-12(10-14)9-13(8-11)6-4-2/h3-4,9,11H,1-2,5-8,10H2 |
| InChIKey | BYXCAMARMAGODU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine?
The IUPAC name of 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine (CID 134890575) is 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine.
What is the SMILES notation for 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine?
The canonical SMILES for 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine is C=CCB1C=C(CCl)CC(CC=C)C1.
What is the InChIKey of 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine?
The InChIKey is BYXCAMARMAGODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BCl/c1-3-5-11-7-12(10-14)9-13(8-11)6-4-2/h3-4,9,11H,1-2,5-8,10H2.
What are the key properties of 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine?
5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine has a molecular weight of 208.54 g/mol, XLogP of 3.97, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-1,3-bis(prop-2-enyl)-3,4-dihydro-2H-borinine is sourced from PubChem (CID 134890575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).