C10H15ClN2O2S — CID 134890739
2-[diamino(chloro)methyl]sulfanyl-6-propan-2-ylbenzene-1,4-diol (PubChem CID 134890739) has the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. Its IUPAC name is 2-[diamino(chloro)methyl]sulfanyl-6-propan-2-ylbenzene-1,4-diol.
| Compound Name | 2-[diamino(chloro)methyl]sulfanyl-6-propan-2-ylbenzene-1,4-diol |
|---|---|
| PubChem CID | 134890739 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-[diamino(chloro)methyl]sulfanyl-6-propan-2-ylbenzene-1,4-diol |
| SMILES | CC(C)c1cc(O)cc(SC(N)(N)Cl)c1O |
| InChI | InChI=1S/C10H15ClN2O2S/c1-5(2)7-3-6(14)4-8(9(7)15)16-10(11,12)13/h3-5,14-15H,12-13H2,1-2H3 |
| InChIKey | DHAQFLRLYJUOSN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|