About ethyl 3-anilinopropanimidate
ethyl 3-anilinopropanimidate (PubChem CID 134890882) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is ethyl 3-anilinopropanimidate.
Molecular Properties
| Compound Name | ethyl 3-anilinopropanimidate |
| PubChem CID | 134890882 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethyl 3-anilinopropanimidate |
| SMILES | [H]/N=C(/CCNc1ccccc1)OCC |
| InChI | InChI=1S/C11H16N2O/c1-2-14-11(12)8-9-13-10-6-4-3-5-7-10/h3-7,12-13H,2,8-9H2,1H3/b12-11- |
| InChIKey | FDAKCCHZEQBOGW-QXMHVHEDSA-N |
| XLogP | 2.50 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-anilinopropanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-anilinopropanimidate?
The IUPAC name of ethyl 3-anilinopropanimidate (CID 134890882) is ethyl 3-anilinopropanimidate.
What is the SMILES notation for ethyl 3-anilinopropanimidate?
The canonical SMILES for ethyl 3-anilinopropanimidate is [H]/N=C(/CCNc1ccccc1)OCC.
What is the InChIKey of ethyl 3-anilinopropanimidate?
The InChIKey is FDAKCCHZEQBOGW-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H16N2O/c1-2-14-11(12)8-9-13-10-6-4-3-5-7-10/h3-7,12-13H,2,8-9H2,1H3/b12-11-.
What are the key properties of ethyl 3-anilinopropanimidate?
ethyl 3-anilinopropanimidate has a molecular weight of 192.26 g/mol, XLogP of 2.50, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-anilinopropanimidate is sourced from PubChem (CID 134890882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).