About (2-phosphanylphenyl) propanoate
(2-phosphanylphenyl) propanoate (PubChem CID 134890910) has the molecular formula C9H11O2P
and a molecular weight of 182.16 g/mol. Its IUPAC name is (2-phosphanylphenyl) propanoate.
Molecular Properties
| Compound Name | (2-phosphanylphenyl) propanoate |
| PubChem CID | 134890910 |
| Molecular Formula | C9H11O2P |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | (2-phosphanylphenyl) propanoate |
| SMILES | CCC(=O)Oc1ccccc1P |
| InChI | InChI=1S/C9H11O2P/c1-2-9(10)11-7-5-3-4-6-8(7)12/h3-6H,2,12H2,1H3 |
| InChIKey | ZVIFTKFMJHLRAC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-phosphanylphenyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phosphanylphenyl) propanoate?
The IUPAC name of (2-phosphanylphenyl) propanoate (CID 134890910) is (2-phosphanylphenyl) propanoate.
What is the SMILES notation for (2-phosphanylphenyl) propanoate?
The canonical SMILES for (2-phosphanylphenyl) propanoate is CCC(=O)Oc1ccccc1P.
What is the InChIKey of (2-phosphanylphenyl) propanoate?
The InChIKey is ZVIFTKFMJHLRAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O2P/c1-2-9(10)11-7-5-3-4-6-8(7)12/h3-6H,2,12H2,1H3.
What are the key properties of (2-phosphanylphenyl) propanoate?
(2-phosphanylphenyl) propanoate has a molecular weight of 182.16 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phosphanylphenyl) propanoate is sourced from PubChem (CID 134890910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).