About [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride
[amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride (PubChem CID 134891112) has the molecular formula C9H13ClN2O2S
and a molecular weight of 248.73 g/mol. Its IUPAC name is [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride.
Molecular Properties
| Compound Name | [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride |
| PubChem CID | 134891112 |
| Molecular Formula | C9H13ClN2O2S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride |
| SMILES | Cc1cc(O)c(C)c(SC(N)=[NH2+])c1O.[Cl-] |
| InChI | InChI=1S/C9H12N2O2S.ClH/c1-4-3-6(12)5(2)8(7(4)13)14-9(10)11;/h3,12-13H,1-2H3,(H3,10,11);1H |
| InChIKey | ODOCJSZKKWMWCS-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride?
The IUPAC name of [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride (CID 134891112) is [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride.
What is the SMILES notation for [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride?
The canonical SMILES for [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride is Cc1cc(O)c(C)c(SC(N)=[NH2+])c1O.[Cl-].
What is the InChIKey of [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride?
The InChIKey is ODOCJSZKKWMWCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S.ClH/c1-4-3-6(12)5(2)8(7(4)13)14-9(10)11;/h3,12-13H,1-2H3,(H3,10,11);1H.
What are the key properties of [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride?
[amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride has a molecular weight of 248.73 g/mol, XLogP of -3.12, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [amino-(2,5-dihydroxy-3,6-dimethylphenyl)sulfanylmethylidene]azanium chloride is sourced from PubChem (CID 134891112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).