C14H23N — CID 134891208
3,5-ditert-butyl-3H-azepine (PubChem CID 134891208) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 3,5-ditert-butyl-3H-azepine.
| Compound Name | 3,5-ditert-butyl-3H-azepine |
|---|---|
| PubChem CID | 134891208 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 3,5-ditert-butyl-3H-azepine |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)C=NC=C1 |
| InChI | InChI=1S/C14H23N/c1-13(2,3)11-7-8-15-10-12(9-11)14(4,5)6/h7-10,12H,1-6H3 |
| InChIKey | POAHUCBRRDLJJA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |