About hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one
hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one (PubChem CID 134891555) has the molecular formula C9H12N4O2
and a molecular weight of 208.22 g/mol. Its IUPAC name is hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one |
| PubChem CID | 134891555 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one |
| SMILES | NN.O=c1[nH][nH]c(O)c1-c1ccccc1 |
| InChI | InChI=1S/C9H8N2O2.H4N2/c12-8-7(9(13)11-10-8)6-4-2-1-3-5-6;1-2/h1-5H,(H3,10,11,12,13);1-2H2 |
| InChIKey | BTTUZSZPLOFXOT-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 120.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one?
The IUPAC name of hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one (CID 134891555) is hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one.
What is the SMILES notation for hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one?
The canonical SMILES for hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one is NN.O=c1[nH][nH]c(O)c1-c1ccccc1.
What is the InChIKey of hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one?
The InChIKey is BTTUZSZPLOFXOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2.H4N2/c12-8-7(9(13)11-10-8)6-4-2-1-3-5-6;1-2/h1-5H,(H3,10,11,12,13);1-2H2.
What are the key properties of hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one?
hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one has a molecular weight of 208.22 g/mol, XLogP of -0.11, 1 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;5-hydroxy-4-phenyl-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 134891555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).