About (4-methylphenyl) N,N-diethylcarbamimidate
(4-methylphenyl) N,N-diethylcarbamimidate (PubChem CID 134892041) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is (4-methylphenyl) N,N-diethylcarbamimidate.
Molecular Properties
| Compound Name | (4-methylphenyl) N,N-diethylcarbamimidate |
| PubChem CID | 134892041 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (4-methylphenyl) N,N-diethylcarbamimidate |
| SMILES | [H]/N=C(/Oc1ccc(C)cc1)N(CC)CC |
| InChI | InChI=1S/C12H18N2O/c1-4-14(5-2)12(13)15-11-8-6-10(3)7-9-11/h6-9,13H,4-5H2,1-3H3/b13-12+ |
| InChIKey | JCXGLNVRUBJCIV-OUKQBFOZSA-N |
| XLogP | 2.65 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) N,N-diethylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) N,N-diethylcarbamimidate?
The IUPAC name of (4-methylphenyl) N,N-diethylcarbamimidate (CID 134892041) is (4-methylphenyl) N,N-diethylcarbamimidate.
What is the SMILES notation for (4-methylphenyl) N,N-diethylcarbamimidate?
The canonical SMILES for (4-methylphenyl) N,N-diethylcarbamimidate is [H]/N=C(/Oc1ccc(C)cc1)N(CC)CC.
What is the InChIKey of (4-methylphenyl) N,N-diethylcarbamimidate?
The InChIKey is JCXGLNVRUBJCIV-OUKQBFOZSA-N. The full InChI is InChI=1S/C12H18N2O/c1-4-14(5-2)12(13)15-11-8-6-10(3)7-9-11/h6-9,13H,4-5H2,1-3H3/b13-12+.
What are the key properties of (4-methylphenyl) N,N-diethylcarbamimidate?
(4-methylphenyl) N,N-diethylcarbamimidate has a molecular weight of 206.29 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) N,N-diethylcarbamimidate is sourced from PubChem (CID 134892041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).