C28H50O4Si — CID 134892174
(1S,2S,3S,5S,8S,10S,14S)-10-[diethyl(propan-2-yl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5,14-triol (PubChem CID 134892174) has the molecular formula C28H50O4Si and a molecular weight of 478.79 g/mol. Its IUPAC name is (1S,2S,3S,5S,8S,10S,14S)-10-[diethyl(propan-2-yl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5,14-triol.
| Compound Name | (1S,2S,3S,5S,8S,10S,14S)-10-[diethyl(propan-2-yl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5,14-triol |
|---|---|
| PubChem CID | 134892174 |
| Molecular Formula | C28H50O4Si |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | (1S,2S,3S,5S,8S,10S,14S)-10-[diethyl(propan-2-yl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5,14-triol |
| SMILES | C=C1[C@@H](O)CC[C@@]2(C)C[C@H](O[Si](CC)(CC)C(C)C)C3=C(C)C[C@H](O)[C@@](C)([C@@H](O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C28H50O4Si/c1-11-33(12-2,17(3)4)32-21-16-27(9)14-13-20(29)19(6)24(27)25(31)28(10)22(30)15-18(5)23(21)26(28,7)8/h17,20-22,24-25,29-31H,6,11-16H2,1-5,7-10H3/t20-,21-,22-,24-,25-,27-,28-/m0/s1 |
| InChIKey | KSPQBPZEEKOHGS-UHLUMWOASA-N |
| XLogP | 5.98 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|