About (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol
(2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 134892653) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
Molecular Properties
| Compound Name | (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| PubChem CID | 134892653 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | CCCCO[C@@H](CO)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H22O4/c1-4-5-6-13-9(7-12)10-8-14-11(2,3)15-10/h9-10,12H,4-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | AVARNMKDBOGIMB-UWVGGRQHSA-N |
| XLogP | 1.32 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol?
The IUPAC name of (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (CID 134892653) is (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
What is the SMILES notation for (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol?
The canonical SMILES for (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol is CCCCO[C@@H](CO)[C@@H]1COC(C)(C)O1.
What is the InChIKey of (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol?
The InChIKey is AVARNMKDBOGIMB-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H22O4/c1-4-5-6-13-9(7-12)10-8-14-11(2,3)15-10/h9-10,12H,4-8H2,1-3H3/t9-,10-/m0/s1.
What are the key properties of (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol?
(2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol has a molecular weight of 218.29 g/mol, XLogP of 1.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol is sourced from PubChem (CID 134892653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).