About 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea
3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea (PubChem CID 134892709) has the molecular formula C9H13N3O4
and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea.
Molecular Properties
| Compound Name | 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea |
| PubChem CID | 134892709 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea |
| SMILES | COc1cc(NC(=O)N(C)O)nc(OC)c1 |
| InChI | InChI=1S/C9H13N3O4/c1-12(14)9(13)11-7-4-6(15-2)5-8(10-7)16-3/h4-5,14H,1-3H3,(H,10,11,13) |
| InChIKey | QNCHNSSBSZZVCN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea?
The IUPAC name of 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea (CID 134892709) is 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea.
What is the SMILES notation for 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea?
The canonical SMILES for 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea is COc1cc(NC(=O)N(C)O)nc(OC)c1.
What is the InChIKey of 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea?
The InChIKey is QNCHNSSBSZZVCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4/c1-12(14)9(13)11-7-4-6(15-2)5-8(10-7)16-3/h4-5,14H,1-3H3,(H,10,11,13).
What are the key properties of 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea?
3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea has a molecular weight of 227.22 g/mol, XLogP of 0.95, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-dimethoxy-2-pyridinyl)-1-hydroxy-1-methylurea is sourced from PubChem (CID 134892709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).