C13H15NO2 — CID 134892857
ethyl (5aR,9aS)-5a,9a-dihydro-1-benzazepine-1-carboxylate (PubChem CID 134892857) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is ethyl (5aR,9aS)-5a,9a-dihydro-1-benzazepine-1-carboxylate.
| Compound Name | ethyl (5aR,9aS)-5a,9a-dihydro-1-benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 134892857 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | ethyl (5aR,9aS)-5a,9a-dihydro-1-benzazepine-1-carboxylate |
| SMILES | CCOC(=O)N1C=CC=C[C@H]2C=CC=C[C@@H]21 |
| InChI | InChI=1S/C13H15NO2/c1-2-16-13(15)14-10-6-5-8-11-7-3-4-9-12(11)14/h3-12H,2H2,1H3/t11-,12+/m1/s1 |
| InChIKey | QSLIIZDYRVPJNW-NEPJUHHUSA-N |
| XLogP | 2.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |