C14H11N3O — CID 134892898
7-imino-12,13-dimethylidene-14-oxa-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),5,9-tetraen-5-amine (PubChem CID 134892898) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 7-imino-12,13-dimethylidene-14-oxa-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),5,9-tetraen-5-amine.
| Compound Name | 7-imino-12,13-dimethylidene-14-oxa-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),5,9-tetraen-5-amine |
|---|---|
| PubChem CID | 134892898 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 7-imino-12,13-dimethylidene-14-oxa-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),5,9-tetraen-5-amine |
| SMILES | [H]/N=C1\N=C(N)c2cc3c(cc21)C1OC3C(=C)C1=C |
| InChI | InChI=1S/C14H11N3O/c1-5-6(2)12-8-4-10-9(13(15)17-14(10)16)3-7(8)11(5)18-12/h3-4,11-12H,1-2H2,(H3,15,16,17) |
| InChIKey | ZJMONHZZKCJRRB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|